About 2-chloro-9-pyridin-2-yl-1,10-phenanthroline
2-chloro-9-pyridin-2-yl-1,10-phenanthroline (PubChem CID 170902643) has the molecular formula C17H10ClN3
and a molecular weight of 291.74 g/mol. Its IUPAC name is 2-chloro-9-pyridin-2-yl-1,10-phenanthroline.
Molecular Properties
| Compound Name | 2-chloro-9-pyridin-2-yl-1,10-phenanthroline |
| PubChem CID | 170902643 |
| Molecular Formula | C17H10ClN3 |
| Molecular Weight | 291.74 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | 2-chloro-9-pyridin-2-yl-1,10-phenanthroline |
| SMILES | Clc1ccc2ccc3ccc(-c4ccccn4)nc3c2n1 |
| InChI | InChI=1S/C17H10ClN3/c18-15-9-7-12-5-4-11-6-8-14(13-3-1-2-10-19-13)20-16(11)17(12)21-15/h1-10H |
| InChIKey | ZUMKAKCIJKFWGG-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.74 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-9-pyridin-2-yl-1,10-phenanthroline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-9-pyridin-2-yl-1,10-phenanthroline?
The IUPAC name of 2-chloro-9-pyridin-2-yl-1,10-phenanthroline (CID 170902643) is 2-chloro-9-pyridin-2-yl-1,10-phenanthroline.
What is the SMILES notation for 2-chloro-9-pyridin-2-yl-1,10-phenanthroline?
The canonical SMILES for 2-chloro-9-pyridin-2-yl-1,10-phenanthroline is Clc1ccc2ccc3ccc(-c4ccccn4)nc3c2n1.
What is the InChIKey of 2-chloro-9-pyridin-2-yl-1,10-phenanthroline?
The InChIKey is ZUMKAKCIJKFWGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10ClN3/c18-15-9-7-12-5-4-11-6-8-14(13-3-1-2-10-19-13)20-16(11)17(12)21-15/h1-10H.
What are the key properties of 2-chloro-9-pyridin-2-yl-1,10-phenanthroline?
2-chloro-9-pyridin-2-yl-1,10-phenanthroline has a molecular weight of 291.74 g/mol, XLogP of 4.50, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-9-pyridin-2-yl-1,10-phenanthroline is sourced from PubChem (CID 170902643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).