C92H68B6F18N6O16 — CID 157440684
CID 157440684 (PubChem CID 157440684) has the molecular formula C92H68B6F18N6O16 and a molecular weight of 1920.42 g/mol.
| Compound Name | CID 157440684 |
|---|---|
| PubChem CID | 157440684 |
| Molecular Formula | C92H68B6F18N6O16 |
| Molecular Weight | 1920.42 g/mol |
| Exact Mass | 1920.50 |
| IUPAC Name | — |
| SMILES | CCOC(C)C.[B]Oc1ccc(C(c2ccc(O[B])c(N3C(=O)C4C5C=CC(C5)C4C3=O)c2)(C(F)(F)F)C(F)(F)F)cc1NC(=O)c1cccc(C(C)=O)c1.[B]Oc1ccc(C(c2ccc(O[B])c(NC(=O)c3ccc(Oc4ccc(C(=O)Nc5cc(C(c6ccc(O[B])c(N7C(=O)C8C9C=CC(C9)C8C7=O)c6)(C(F)(F)F)C(F)(F)F)ccc5O[B])cc4)cc3)c2)(C(F)(F)F)C(F)(F)F)cc1NC |
| InChI | InChI=1S/C54H34B4F12N4O9.C33H22B2F6N2O6.C5H12O/c1-71-35-21-29(8-16-39(35)80-55)49(51(59,60)61,52(62,63)64)30-9-17-40(81-56)36(22-30)72-45(75)25-4-12-33(13-5-25)79-34-14-6-26(7-15-34)46(76)73-37-23-31(10-18-41(37)82-57)50(53(65,66)67,54(68,69)70)32-11-19-42(83-58)38(24-32)74-47(77)43-27-2-3-28(20-27)44(43)48(74)78;1-15(44)16-3-2-4-19(11-16)28(45)42-22-13-20(7-9-24(22)48-34)31(32(36,37)38,33(39,40)41)21-8-10-25(49-35)23(14-21)43-29(46)26-17-5-6-18(12-17)27(26)30(43)47;1-4-6-5(2)3/h2-19,21-24,27-28,43-44,71H,20H2,1H3,(H,72,75)(H,73,76);2-11,13-14,17-18,26-27H,12H2,1H3,(H,42,45);5H,4H2,1-3H3 |
| InChIKey | LUMYOACKFPDREU-UHFFFAOYSA-N |
| XLogP | 18.23 |
| TPSA | 265.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 138 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1920.42 |
| LogP ≤ 5 | 18.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|