C35H24N6O2S2 — CID 157443284
7-(1-benzothiophen-2-yl)-1H-indazol-5-amine;N-[7-(1-benzothiophen-2-yl)-1H-indazol-5-yl]furan-2-carboxamide (PubChem CID 157443284) has the molecular formula C35H24N6O2S2 and a molecular weight of 624.75 g/mol. Its IUPAC name is 7-(1-benzothiophen-2-yl)-1H-indazol-5-amine;N-[7-(1-benzothiophen-2-yl)-1H-indazol-5-yl]furan-2-carboxamide.
| Compound Name | 7-(1-benzothiophen-2-yl)-1H-indazol-5-amine;N-[7-(1-benzothiophen-2-yl)-1H-indazol-5-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 157443284 |
| Molecular Formula | C35H24N6O2S2 |
| Molecular Weight | 624.75 g/mol |
| Exact Mass | 624.14 |
| IUPAC Name | 7-(1-benzothiophen-2-yl)-1H-indazol-5-amine;N-[7-(1-benzothiophen-2-yl)-1H-indazol-5-yl]furan-2-carboxamide |
| SMILES | Nc1cc(-c2cc3ccccc3s2)c2[nH]ncc2c1.O=C(Nc1cc(-c2cc3ccccc3s2)c2[nH]ncc2c1)c1ccco1 |
| InChI | InChI=1S/C20H13N3O2S.C15H11N3S/c24-20(16-5-3-7-25-16)22-14-8-13-11-21-23-19(13)15(10-14)18-9-12-4-1-2-6-17(12)26-18;16-11-5-10-8-17-18-15(10)12(7-11)14-6-9-3-1-2-4-13(9)19-14/h1-11H,(H,21,23)(H,22,24);1-8H,16H2,(H,17,18) |
| InChIKey | BRXUBEKBUGYSEL-UHFFFAOYSA-N |
| XLogP | 9.32 |
| TPSA | 125.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.75 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|