C19H25NO3 — CID 157444555
1-[4-(2,5-dimethylpyrrol-1-yl)-2-hydroxy-6-methoxyphenyl]-3,3-dimethylbutan-1-one (PubChem CID 157444555) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is 1-[4-(2,5-dimethylpyrrol-1-yl)-2-hydroxy-6-methoxyphenyl]-3,3-dimethylbutan-1-one.
| Compound Name | 1-[4-(2,5-dimethylpyrrol-1-yl)-2-hydroxy-6-methoxyphenyl]-3,3-dimethylbutan-1-one |
|---|---|
| PubChem CID | 157444555 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | 1-[4-(2,5-dimethylpyrrol-1-yl)-2-hydroxy-6-methoxyphenyl]-3,3-dimethylbutan-1-one |
| SMILES | COc1cc(-n2c(C)ccc2C)cc(O)c1C(=O)CC(C)(C)C |
| InChI | InChI=1S/C19H25NO3/c1-12-7-8-13(2)20(12)14-9-15(21)18(17(10-14)23-6)16(22)11-19(3,4)5/h7-10,21H,11H2,1-6H3 |
| InChIKey | VUMYLUNFVQKOJT-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|