C35H45Cl3N10O2 — CID 157445114
6-chloro-4-N-(3-chloro-4-methoxyphenyl)-2-N-cycloheptyl-1,3,5-triazine-2,4-diamine;4-N-(3-chloro-4-methoxyphenyl)-2-N-cycloheptyl-6-methyl-1,3,5-triazine-2,4-diamine (PubChem CID 157445114) has the molecular formula C35H45Cl3N10O2 and a molecular weight of 744.17 g/mol. Its IUPAC name is 6-chloro-4-N-(3-chloro-4-methoxyphenyl)-2-N-cycloheptyl-1,3,5-triazine-2,4-diamine;4-N-(3-chloro-4-methoxyphenyl)-2-N-cycloheptyl-6-methyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-4-N-(3-chloro-4-methoxyphenyl)-2-N-cycloheptyl-1,3,5-triazine-2,4-diamine;4-N-(3-chloro-4-methoxyphenyl)-2-N-cycloheptyl-6-methyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 157445114 |
| Molecular Formula | C35H45Cl3N10O2 |
| Molecular Weight | 744.17 g/mol |
| Exact Mass | 742.28 |
| IUPAC Name | 6-chloro-4-N-(3-chloro-4-methoxyphenyl)-2-N-cycloheptyl-1,3,5-triazine-2,4-diamine;4-N-(3-chloro-4-methoxyphenyl)-2-N-cycloheptyl-6-methyl-1,3,5-triazine-2,4-diamine |
| SMILES | COc1ccc(Nc2nc(C)nc(NC3CCCCCC3)n2)cc1Cl.COc1ccc(Nc2nc(Cl)nc(NC3CCCCCC3)n2)cc1Cl |
| InChI | InChI=1S/C18H24ClN5O.C17H21Cl2N5O/c1-12-20-17(22-13-7-5-3-4-6-8-13)24-18(21-12)23-14-9-10-16(25-2)15(19)11-14;1-25-14-9-8-12(10-13(14)18)21-17-23-15(19)22-16(24-17)20-11-6-4-2-3-5-7-11/h9-11,13H,3-8H2,1-2H3,(H2,20,21,22,23,24);8-11H,2-7H2,1H3,(H2,20,21,22,23,24) |
| InChIKey | BSCYXLZRBFTSGS-UHFFFAOYSA-N |
| XLogP | 9.79 |
| TPSA | 143.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.17 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |