C24H36ClN7O3 — CID 11627558
tert-butyl N-[2-[[4-(3-chloro-4-methoxyanilino)-6-(cycloheptylamino)-1,3,5-triazin-2-yl]amino]ethyl]carbamate (PubChem CID 11627558) has the molecular formula C24H36ClN7O3 and a molecular weight of 506.05 g/mol. Its IUPAC name is tert-butyl N-[2-[[4-(3-chloro-4-methoxyanilino)-6-(cycloheptylamino)-1,3,5-triazin-2-yl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[4-(3-chloro-4-methoxyanilino)-6-(cycloheptylamino)-1,3,5-triazin-2-yl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 11627558 |
| Molecular Formula | C24H36ClN7O3 |
| Molecular Weight | 506.05 g/mol |
| Exact Mass | 505.26 |
| IUPAC Name | tert-butyl N-[2-[[4-(3-chloro-4-methoxyanilino)-6-(cycloheptylamino)-1,3,5-triazin-2-yl]amino]ethyl]carbamate |
| SMILES | COc1ccc(Nc2nc(NCCNC(=O)OC(C)(C)C)nc(NC3CCCCCC3)n2)cc1Cl |
| InChI | InChI=1S/C24H36ClN7O3/c1-24(2,3)35-23(33)27-14-13-26-20-30-21(28-16-9-7-5-6-8-10-16)32-22(31-20)29-17-11-12-19(34-4)18(25)15-17/h11-12,15-16H,5-10,13-14H2,1-4H3,(H,27,33)(H3,26,28,29,30,31,32) |
| InChIKey | OZKNPPRRLHMZIA-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.05 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|