C29H42ClN9O3S — CID 11635913
N-[2-[[4-(3-chloro-4-methoxyanilino)-6-(cycloheptylamino)-1,3,5-triazin-2-yl]amino]ethyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide (PubChem CID 11635913) has the molecular formula C29H42ClN9O3S and a molecular weight of 632.24 g/mol. Its IUPAC name is N-[2-[[4-(3-chloro-4-methoxyanilino)-6-(cycloheptylamino)-1,3,5-triazin-2-yl]amino]ethyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide.
| Compound Name | N-[2-[[4-(3-chloro-4-methoxyanilino)-6-(cycloheptylamino)-1,3,5-triazin-2-yl]amino]ethyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide |
|---|---|
| PubChem CID | 11635913 |
| Molecular Formula | C29H42ClN9O3S |
| Molecular Weight | 632.24 g/mol |
| Exact Mass | 631.28 |
| IUPAC Name | N-[2-[[4-(3-chloro-4-methoxyanilino)-6-(cycloheptylamino)-1,3,5-triazin-2-yl]amino]ethyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide |
| SMILES | COc1ccc(Nc2nc(NCCNC(=O)CCCCC3SCC4NC(=O)NC43)nc(NC3CCCCCC3)n2)cc1Cl |
| InChI | InChI=1S/C29H42ClN9O3S/c1-42-22-13-12-19(16-20(22)30)34-28-38-26(37-27(39-28)33-18-8-4-2-3-5-9-18)32-15-14-31-24(40)11-7-6-10-23-25-21(17-43-23)35-29(41)36-25/h12-13,16,18,21,23,25H,2-11,14-15,17H2,1H3,(H,31,40)(H2,35,36,41)(H3,32,33,34,37,38,39) |
| InChIKey | OLDICBHRIBPLFJ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 154.22 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.24 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|