C21H32N4O5S — CID 25212606
5-[(3aR,4R,6aS)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[6-[(2-methoxy-3,4-dioxocyclobuten-1-yl)amino]hexyl]pentanamide (PubChem CID 25212606) has the molecular formula C21H32N4O5S and a molecular weight of 452.58 g/mol. Its IUPAC name is 5-[(3aR,4R,6aS)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[6-[(2-methoxy-3,4-dioxocyclobuten-1-yl)amino]hexyl]pentanamide.
| Compound Name | 5-[(3aR,4R,6aS)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[6-[(2-methoxy-3,4-dioxocyclobuten-1-yl)amino]hexyl]pentanamide |
|---|---|
| PubChem CID | 25212606 |
| Molecular Formula | C21H32N4O5S |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | 5-[(3aR,4R,6aS)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[6-[(2-methoxy-3,4-dioxocyclobuten-1-yl)amino]hexyl]pentanamide |
| SMILES | COc1c(NCCCCCCNC(=O)CCCC[C@H]2SC[C@H]3NC(=O)N[C@H]32)c(=O)c1=O |
| InChI | InChI=1S/C21H32N4O5S/c1-30-20-17(18(27)19(20)28)23-11-7-3-2-6-10-22-15(26)9-5-4-8-14-16-13(12-31-14)24-21(29)25-16/h13-14,16,23H,2-12H2,1H3,(H,22,26)(H2,24,25,29)/t13-,14-,16-/m1/s1 |
| InChIKey | XRZPHGXPFAHMQU-IIAWOOMASA-N |
| XLogP | 1.11 |
| TPSA | 125.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|