C24H34AsClN6O — CID 87926427
CID 87926427 (PubChem CID 87926427) has the molecular formula C24H34AsClN6O and a molecular weight of 532.95 g/mol.
| Compound Name | CID 87926427 |
|---|---|
| PubChem CID | 87926427 |
| Molecular Formula | C24H34AsClN6O |
| Molecular Weight | 532.95 g/mol |
| Exact Mass | 532.17 |
| IUPAC Name | — |
| SMILES | COc1ccc(Nc2nc(NC3CCCCCC3)nc(N(C)C3CCCCC3[As])n2)cc1Cl |
| InChI | InChI=1S/C24H34AsClN6O/c1-32(20-12-8-7-11-18(20)25)24-30-22(27-16-9-5-3-4-6-10-16)29-23(31-24)28-17-13-14-21(33-2)19(26)15-17/h13-16,18,20H,3-12H2,1-2H3,(H2,27,28,29,30,31) |
| InChIKey | CJLJZOHSUNFOML-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 75.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.95 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|