About 4-chloro-7-ethyl-1H-indole-5-carboxylic acid;methyl 4-chloro-7-methyl-1H-indole-5-carboxylate
4-chloro-7-ethyl-1H-indole-5-carboxylic acid;methyl 4-chloro-7-methyl-1H-indole-5-carboxylate (PubChem CID 157445689) has the molecular formula C22H20Cl2N2O4
and a molecular weight of 447.32 g/mol. Its IUPAC name is 4-chloro-7-ethyl-1H-indole-5-carboxylic acid;methyl 4-chloro-7-methyl-1H-indole-5-carboxylate.
Molecular Properties
| Compound Name | 4-chloro-7-ethyl-1H-indole-5-carboxylic acid;methyl 4-chloro-7-methyl-1H-indole-5-carboxylate |
| PubChem CID | 157445689 |
| Molecular Formula | C22H20Cl2N2O4 |
| Molecular Weight | 447.32 g/mol |
| Exact Mass | 446.08 |
| IUPAC Name | 4-chloro-7-ethyl-1H-indole-5-carboxylic acid;methyl 4-chloro-7-methyl-1H-indole-5-carboxylate |
| SMILES | CCc1cc(C(=O)O)c(Cl)c2cc[nH]c12.COC(=O)c1cc(C)c2[nH]ccc2c1Cl |
| InChI | InChI=1S/2C11H10ClNO2/c1-6-5-8(11(14)15-2)9(12)7-3-4-13-10(6)7;1-2-6-5-8(11(14)15)9(12)7-3-4-13-10(6)7/h3-5,13H,1-2H3;3-5,13H,2H2,1H3,(H,14,15) |
| InChIKey | BSERMUZYXOBZBD-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 447.32 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-chloro-7-ethyl-1H-indole-5-carboxylic acid;methyl 4-chloro-7-methyl-1H-indole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-7-ethyl-1H-indole-5-carboxylic acid;methyl 4-chloro-7-methyl-1H-indole-5-carboxylate?
The IUPAC name of 4-chloro-7-ethyl-1H-indole-5-carboxylic acid;methyl 4-chloro-7-methyl-1H-indole-5-carboxylate (CID 157445689) is 4-chloro-7-ethyl-1H-indole-5-carboxylic acid;methyl 4-chloro-7-methyl-1H-indole-5-carboxylate.
What is the SMILES notation for 4-chloro-7-ethyl-1H-indole-5-carboxylic acid;methyl 4-chloro-7-methyl-1H-indole-5-carboxylate?
The canonical SMILES for 4-chloro-7-ethyl-1H-indole-5-carboxylic acid;methyl 4-chloro-7-methyl-1H-indole-5-carboxylate is CCc1cc(C(=O)O)c(Cl)c2cc[nH]c12.COC(=O)c1cc(C)c2[nH]ccc2c1Cl.
What is the InChIKey of 4-chloro-7-ethyl-1H-indole-5-carboxylic acid;methyl 4-chloro-7-methyl-1H-indole-5-carboxylate?
The InChIKey is BSERMUZYXOBZBD-UHFFFAOYSA-N. The full InChI is InChI=1S/2C11H10ClNO2/c1-6-5-8(11(14)15-2)9(12)7-3-4-13-10(6)7;1-2-6-5-8(11(14)15)9(12)7-3-4-13-10(6)7/h3-5,13H,1-2H3;3-5,13H,2H2,1H3,(H,14,15).
What are the key properties of 4-chloro-7-ethyl-1H-indole-5-carboxylic acid;methyl 4-chloro-7-methyl-1H-indole-5-carboxylate?
4-chloro-7-ethyl-1H-indole-5-carboxylic acid;methyl 4-chloro-7-methyl-1H-indole-5-carboxylate has a molecular weight of 447.32 g/mol, XLogP of 6.00, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-7-ethyl-1H-indole-5-carboxylic acid;methyl 4-chloro-7-methyl-1H-indole-5-carboxylate is sourced from PubChem (CID 157445689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).