C26H28ClN3O4 — CID 158270478
4-chloro-7-[2-[(2-methylpropan-2-yl)oxy]ethoxy]-1H-indole-5-carboxylic acid;4,7-dimethyl-1H-indole-5-carbonitrile (PubChem CID 158270478) has the molecular formula C26H28ClN3O4 and a molecular weight of 481.98 g/mol. Its IUPAC name is 4-chloro-7-[2-[(2-methylpropan-2-yl)oxy]ethoxy]-1H-indole-5-carboxylic acid;4,7-dimethyl-1H-indole-5-carbonitrile.
| Compound Name | 4-chloro-7-[2-[(2-methylpropan-2-yl)oxy]ethoxy]-1H-indole-5-carboxylic acid;4,7-dimethyl-1H-indole-5-carbonitrile |
|---|---|
| PubChem CID | 158270478 |
| Molecular Formula | C26H28ClN3O4 |
| Molecular Weight | 481.98 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | 4-chloro-7-[2-[(2-methylpropan-2-yl)oxy]ethoxy]-1H-indole-5-carboxylic acid;4,7-dimethyl-1H-indole-5-carbonitrile |
| SMILES | CC(C)(C)OCCOc1cc(C(=O)O)c(Cl)c2cc[nH]c12.Cc1c(C#N)cc(C)c2[nH]ccc12 |
| InChI | InChI=1S/C15H18ClNO4.C11H10N2/c1-15(2,3)21-7-6-20-11-8-10(14(18)19)12(16)9-4-5-17-13(9)11;1-7-5-9(6-12)8(2)10-3-4-13-11(7)10/h4-5,8,17H,6-7H2,1-3H3,(H,18,19);3-5,13H,1-2H3 |
| InChIKey | GIYTWAXZUGCDBL-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.98 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|