About 4-(2-fluorophenyl)benzonitrile;4-(4-fluorophenyl)benzonitrile;4-phenylbenzonitrile
4-(2-fluorophenyl)benzonitrile;4-(4-fluorophenyl)benzonitrile;4-phenylbenzonitrile (PubChem CID 157446413) has the molecular formula C39H25F2N3
and a molecular weight of 573.65 g/mol. Its IUPAC name is 4-(2-fluorophenyl)benzonitrile;4-(4-fluorophenyl)benzonitrile;4-phenylbenzonitrile.
Molecular Properties
| Compound Name | 4-(2-fluorophenyl)benzonitrile;4-(4-fluorophenyl)benzonitrile;4-phenylbenzonitrile |
| PubChem CID | 157446413 |
| Molecular Formula | C39H25F2N3 |
| Molecular Weight | 573.65 g/mol |
| Exact Mass | 573.20 |
| IUPAC Name | 4-(2-fluorophenyl)benzonitrile;4-(4-fluorophenyl)benzonitrile;4-phenylbenzonitrile |
| SMILES | N#Cc1ccc(-c2ccc(F)cc2)cc1.N#Cc1ccc(-c2ccccc2)cc1.N#Cc1ccc(-c2ccccc2F)cc1 |
| InChI | InChI=1S/2C13H8FN.C13H9N/c14-13-7-5-12(6-8-13)11-3-1-10(9-15)2-4-11;14-13-4-2-1-3-12(13)11-7-5-10(9-15)6-8-11;14-10-11-6-8-13(9-7-11)12-4-2-1-3-5-12/h2*1-8H;1-9H |
| InChIKey | BSGUWJQVXLUXSK-UHFFFAOYSA-N |
| XLogP | 9.95 |
| TPSA | 71.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 573.65 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2-fluorophenyl)benzonitrile;4-(4-fluorophenyl)benzonitrile;4-phenylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-fluorophenyl)benzonitrile;4-(4-fluorophenyl)benzonitrile;4-phenylbenzonitrile?
The IUPAC name of 4-(2-fluorophenyl)benzonitrile;4-(4-fluorophenyl)benzonitrile;4-phenylbenzonitrile (CID 157446413) is 4-(2-fluorophenyl)benzonitrile;4-(4-fluorophenyl)benzonitrile;4-phenylbenzonitrile.
What is the SMILES notation for 4-(2-fluorophenyl)benzonitrile;4-(4-fluorophenyl)benzonitrile;4-phenylbenzonitrile?
The canonical SMILES for 4-(2-fluorophenyl)benzonitrile;4-(4-fluorophenyl)benzonitrile;4-phenylbenzonitrile is N#Cc1ccc(-c2ccc(F)cc2)cc1.N#Cc1ccc(-c2ccccc2)cc1.N#Cc1ccc(-c2ccccc2F)cc1.
What is the InChIKey of 4-(2-fluorophenyl)benzonitrile;4-(4-fluorophenyl)benzonitrile;4-phenylbenzonitrile?
The InChIKey is BSGUWJQVXLUXSK-UHFFFAOYSA-N. The full InChI is InChI=1S/2C13H8FN.C13H9N/c14-13-7-5-12(6-8-13)11-3-1-10(9-15)2-4-11;14-13-4-2-1-3-12(13)11-7-5-10(9-15)6-8-11;14-10-11-6-8-13(9-7-11)12-4-2-1-3-5-12/h2*1-8H;1-9H.
What are the key properties of 4-(2-fluorophenyl)benzonitrile;4-(4-fluorophenyl)benzonitrile;4-phenylbenzonitrile?
4-(2-fluorophenyl)benzonitrile;4-(4-fluorophenyl)benzonitrile;4-phenylbenzonitrile has a molecular weight of 573.65 g/mol, XLogP of 9.95, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-fluorophenyl)benzonitrile;4-(4-fluorophenyl)benzonitrile;4-phenylbenzonitrile is sourced from PubChem (CID 157446413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).