C23H22F4N2O7 — CID 157447513
2-[[2-fluoro-5-(trifluoromethoxy)phenyl]-(1-methylpiperidin-4-yl)oxymethyl]-1,3-benzoxazole;oxalic acid (PubChem CID 157447513) has the molecular formula C23H22F4N2O7 and a molecular weight of 514.43 g/mol. Its IUPAC name is 2-[[2-fluoro-5-(trifluoromethoxy)phenyl]-(1-methylpiperidin-4-yl)oxymethyl]-1,3-benzoxazole;oxalic acid.
| Compound Name | 2-[[2-fluoro-5-(trifluoromethoxy)phenyl]-(1-methylpiperidin-4-yl)oxymethyl]-1,3-benzoxazole;oxalic acid |
|---|---|
| PubChem CID | 157447513 |
| Molecular Formula | C23H22F4N2O7 |
| Molecular Weight | 514.43 g/mol |
| Exact Mass | 514.14 |
| IUPAC Name | 2-[[2-fluoro-5-(trifluoromethoxy)phenyl]-(1-methylpiperidin-4-yl)oxymethyl]-1,3-benzoxazole;oxalic acid |
| SMILES | CN1CCC(OC(c2nc3ccccc3o2)c2cc(OC(F)(F)F)ccc2F)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C21H20F4N2O3.C2H2O4/c1-27-10-8-13(9-11-27)28-19(20-26-17-4-2-3-5-18(17)29-20)15-12-14(6-7-16(15)22)30-21(23,24)25;3-1(4)2(5)6/h2-7,12-13,19H,8-11H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | BSKCXIYPBXWSSK-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 122.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.43 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|