C23H24F2N2O5S — CID 159864717
2-[(2,6-difluoro-4-methylphenyl)-(1-methylpiperidin-4-yl)oxymethyl]-1,3-benzothiazole;oxalic acid (PubChem CID 159864717) has the molecular formula C23H24F2N2O5S and a molecular weight of 478.52 g/mol. Its IUPAC name is 2-[(2,6-difluoro-4-methylphenyl)-(1-methylpiperidin-4-yl)oxymethyl]-1,3-benzothiazole;oxalic acid.
| Compound Name | 2-[(2,6-difluoro-4-methylphenyl)-(1-methylpiperidin-4-yl)oxymethyl]-1,3-benzothiazole;oxalic acid |
|---|---|
| PubChem CID | 159864717 |
| Molecular Formula | C23H24F2N2O5S |
| Molecular Weight | 478.52 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | 2-[(2,6-difluoro-4-methylphenyl)-(1-methylpiperidin-4-yl)oxymethyl]-1,3-benzothiazole;oxalic acid |
| SMILES | Cc1cc(F)c(C(OC2CCN(C)CC2)c2nc3ccccc3s2)c(F)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C21H22F2N2OS.C2H2O4/c1-13-11-15(22)19(16(23)12-13)20(26-14-7-9-25(2)10-8-14)21-24-17-5-3-4-6-18(17)27-21;3-1(4)2(5)6/h3-6,11-12,14,20H,7-10H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | NROXOIIUJVGYNV-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 99.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.52 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|