C27H32N2O3S — CID 66836050
tert-butyl (E)-3-[3-[1,3-benzothiazol-2-yl-(1-methylpiperidin-4-yl)oxymethyl]phenyl]prop-2-enoate (PubChem CID 66836050) has the molecular formula C27H32N2O3S and a molecular weight of 464.63 g/mol. Its IUPAC name is tert-butyl (E)-3-[3-[1,3-benzothiazol-2-yl-(1-methylpiperidin-4-yl)oxymethyl]phenyl]prop-2-enoate.
| Compound Name | tert-butyl (E)-3-[3-[1,3-benzothiazol-2-yl-(1-methylpiperidin-4-yl)oxymethyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 66836050 |
| Molecular Formula | C27H32N2O3S |
| Molecular Weight | 464.63 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | tert-butyl (E)-3-[3-[1,3-benzothiazol-2-yl-(1-methylpiperidin-4-yl)oxymethyl]phenyl]prop-2-enoate |
| SMILES | CN1CCC(OC(c2cccc(/C=C/C(=O)OC(C)(C)C)c2)c2nc3ccccc3s2)CC1 |
| InChI | InChI=1S/C27H32N2O3S/c1-27(2,3)32-24(30)13-12-19-8-7-9-20(18-19)25(31-21-14-16-29(4)17-15-21)26-28-22-10-5-6-11-23(22)33-26/h5-13,18,21,25H,14-17H2,1-4H3/b13-12+ |
| InChIKey | TUEIOMCCHSPEST-OUKQBFOZSA-N |
| XLogP | 5.85 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.63 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|