C27H32N2O3S — CID 66836043
5-[3-[1,3-benzothiazol-2-yl-(1-methylpiperidin-4-yl)oxymethyl]phenyl]pent-4-enyl acetate (PubChem CID 66836043) has the molecular formula C27H32N2O3S and a molecular weight of 464.63 g/mol. Its IUPAC name is 5-[3-[1,3-benzothiazol-2-yl-(1-methylpiperidin-4-yl)oxymethyl]phenyl]pent-4-enyl acetate.
| Compound Name | 5-[3-[1,3-benzothiazol-2-yl-(1-methylpiperidin-4-yl)oxymethyl]phenyl]pent-4-enyl acetate |
|---|---|
| PubChem CID | 66836043 |
| Molecular Formula | C27H32N2O3S |
| Molecular Weight | 464.63 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | 5-[3-[1,3-benzothiazol-2-yl-(1-methylpiperidin-4-yl)oxymethyl]phenyl]pent-4-enyl acetate |
| SMILES | CC(=O)OCCCC=Cc1cccc(C(OC2CCN(C)CC2)c2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C27H32N2O3S/c1-20(30)31-18-7-3-4-9-21-10-8-11-22(19-21)26(32-23-14-16-29(2)17-15-23)27-28-24-12-5-6-13-25(24)33-27/h4-6,8-13,19,23,26H,3,7,14-18H2,1-2H3 |
| InChIKey | LGFVHSRFXDABCP-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.63 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|