C21H21F3N2O4S2 — CID 56947871
[3-[1,3-benzothiazol-2-yl-(1-methylpiperidin-4-yl)oxymethyl]phenyl] trifluoromethanesulfonate (PubChem CID 56947871) has the molecular formula C21H21F3N2O4S2 and a molecular weight of 486.54 g/mol. Its IUPAC name is [3-[1,3-benzothiazol-2-yl-(1-methylpiperidin-4-yl)oxymethyl]phenyl] trifluoromethanesulfonate.
| Compound Name | [3-[1,3-benzothiazol-2-yl-(1-methylpiperidin-4-yl)oxymethyl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 56947871 |
| Molecular Formula | C21H21F3N2O4S2 |
| Molecular Weight | 486.54 g/mol |
| Exact Mass | 486.09 |
| IUPAC Name | [3-[1,3-benzothiazol-2-yl-(1-methylpiperidin-4-yl)oxymethyl]phenyl] trifluoromethanesulfonate |
| SMILES | CN1CCC(OC(c2cccc(OS(=O)(=O)C(F)(F)F)c2)c2nc3ccccc3s2)CC1 |
| InChI | InChI=1S/C21H21F3N2O4S2/c1-26-11-9-15(10-12-26)29-19(20-25-17-7-2-3-8-18(17)31-20)14-5-4-6-16(13-14)30-32(27,28)21(22,23)24/h2-8,13,15,19H,9-12H2,1H3 |
| InChIKey | SZLCIXOEBZUJFC-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.54 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|