C27H34N4OS — CID 66835747
2-[[3-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)phenyl]-(1-methylpiperidin-4-yl)oxymethyl]-1,3-benzothiazole (PubChem CID 66835747) has the molecular formula C27H34N4OS and a molecular weight of 462.66 g/mol. Its IUPAC name is 2-[[3-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)phenyl]-(1-methylpiperidin-4-yl)oxymethyl]-1,3-benzothiazole.
| Compound Name | 2-[[3-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)phenyl]-(1-methylpiperidin-4-yl)oxymethyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 66835747 |
| Molecular Formula | C27H34N4OS |
| Molecular Weight | 462.66 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | 2-[[3-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)phenyl]-(1-methylpiperidin-4-yl)oxymethyl]-1,3-benzothiazole |
| SMILES | CN1CCC(OC(c2cccc(N3CC4CN(C)CC4C3)c2)c2nc3ccccc3s2)CC1 |
| InChI | InChI=1S/C27H34N4OS/c1-29-12-10-23(11-13-29)32-26(27-28-24-8-3-4-9-25(24)33-27)19-6-5-7-22(14-19)31-17-20-15-30(2)16-21(20)18-31/h3-9,14,20-21,23,26H,10-13,15-18H2,1-2H3 |
| InChIKey | PTHRTKNGOIDHBY-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 31.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.66 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |