C27H34N4O5S — CID 118862490
1-[3-[1,3-benzothiazol-2-yl-(1-methylpiperidin-4-yl)oxymethyl]phenyl]-N-methylpyrrolidin-3-amine;oxalic acid (PubChem CID 118862490) has the molecular formula C27H34N4O5S and a molecular weight of 526.66 g/mol. Its IUPAC name is 1-[3-[1,3-benzothiazol-2-yl-(1-methylpiperidin-4-yl)oxymethyl]phenyl]-N-methylpyrrolidin-3-amine;oxalic acid.
| Compound Name | 1-[3-[1,3-benzothiazol-2-yl-(1-methylpiperidin-4-yl)oxymethyl]phenyl]-N-methylpyrrolidin-3-amine;oxalic acid |
|---|---|
| PubChem CID | 118862490 |
| Molecular Formula | C27H34N4O5S |
| Molecular Weight | 526.66 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | 1-[3-[1,3-benzothiazol-2-yl-(1-methylpiperidin-4-yl)oxymethyl]phenyl]-N-methylpyrrolidin-3-amine;oxalic acid |
| SMILES | CNC1CCN(c2cccc(C(OC3CCN(C)CC3)c3nc4ccccc4s3)c2)C1.O=C(O)C(=O)O |
| InChI | InChI=1S/C25H32N4OS.C2H2O4/c1-26-19-10-15-29(17-19)20-7-5-6-18(16-20)24(30-21-11-13-28(2)14-12-21)25-27-22-8-3-4-9-23(22)31-25;3-1(4)2(5)6/h3-9,16,19,21,24,26H,10-15,17H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | AMQOUVUSADXCMV-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 115.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.66 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|