C26H27N3OS — CID 56948113
3-[3-[1,3-benzothiazol-2-yl-(1-methylpiperidin-4-yl)oxymethyl]phenyl]aniline (PubChem CID 56948113) has the molecular formula C26H27N3OS and a molecular weight of 429.59 g/mol. Its IUPAC name is 3-[3-[1,3-benzothiazol-2-yl-(1-methylpiperidin-4-yl)oxymethyl]phenyl]aniline.
| Compound Name | 3-[3-[1,3-benzothiazol-2-yl-(1-methylpiperidin-4-yl)oxymethyl]phenyl]aniline |
|---|---|
| PubChem CID | 56948113 |
| Molecular Formula | C26H27N3OS |
| Molecular Weight | 429.59 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | 3-[3-[1,3-benzothiazol-2-yl-(1-methylpiperidin-4-yl)oxymethyl]phenyl]aniline |
| SMILES | CN1CCC(OC(c2cccc(-c3cccc(N)c3)c2)c2nc3ccccc3s2)CC1 |
| InChI | InChI=1S/C26H27N3OS/c1-29-14-12-22(13-15-29)30-25(26-28-23-10-2-3-11-24(23)31-26)20-8-4-6-18(16-20)19-7-5-9-21(27)17-19/h2-11,16-17,22,25H,12-15,27H2,1H3 |
| InChIKey | RMQAATDVFBAOQG-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.59 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|