C26H31N5OS — CID 67513044
2-[5-[3-[1,3-benzothiazol-2-yl-(1-methylpiperidin-4-yl)oxymethyl]phenyl]pent-4-ynyl]guanidine (PubChem CID 67513044) has the molecular formula C26H31N5OS and a molecular weight of 461.64 g/mol. Its IUPAC name is 2-[5-[3-[1,3-benzothiazol-2-yl-(1-methylpiperidin-4-yl)oxymethyl]phenyl]pent-4-ynyl]guanidine.
| Compound Name | 2-[5-[3-[1,3-benzothiazol-2-yl-(1-methylpiperidin-4-yl)oxymethyl]phenyl]pent-4-ynyl]guanidine |
|---|---|
| PubChem CID | 67513044 |
| Molecular Formula | C26H31N5OS |
| Molecular Weight | 461.64 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | 2-[5-[3-[1,3-benzothiazol-2-yl-(1-methylpiperidin-4-yl)oxymethyl]phenyl]pent-4-ynyl]guanidine |
| SMILES | CN1CCC(OC(c2cccc(C#CCCCN=C(N)N)c2)c2nc3ccccc3s2)CC1 |
| InChI | InChI=1S/C26H31N5OS/c1-31-16-13-21(14-17-31)32-24(25-30-22-11-4-5-12-23(22)33-25)20-10-7-9-19(18-20)8-3-2-6-15-29-26(27)28/h4-5,7,9-12,18,21,24H,2,6,13-17H2,1H3,(H4,27,28,29) |
| InChIKey | JBKOUTQZBDRDNL-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 89.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.64 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|