C25H30N6O — CID 67512103
2-[4-[3-[1H-benzimidazol-2-yl-(1-methylpiperidin-4-yl)oxymethyl]phenyl]but-3-ynyl]guanidine (PubChem CID 67512103) has the molecular formula C25H30N6O and a molecular weight of 430.56 g/mol. Its IUPAC name is 2-[4-[3-[1H-benzimidazol-2-yl-(1-methylpiperidin-4-yl)oxymethyl]phenyl]but-3-ynyl]guanidine.
| Compound Name | 2-[4-[3-[1H-benzimidazol-2-yl-(1-methylpiperidin-4-yl)oxymethyl]phenyl]but-3-ynyl]guanidine |
|---|---|
| PubChem CID | 67512103 |
| Molecular Formula | C25H30N6O |
| Molecular Weight | 430.56 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | 2-[4-[3-[1H-benzimidazol-2-yl-(1-methylpiperidin-4-yl)oxymethyl]phenyl]but-3-ynyl]guanidine |
| SMILES | CN1CCC(OC(c2cccc(C#CCCN=C(N)N)c2)c2nc3ccccc3[nH]2)CC1 |
| InChI | InChI=1S/C25H30N6O/c1-31-15-12-20(13-16-31)32-23(24-29-21-10-2-3-11-22(21)30-24)19-9-6-8-18(17-19)7-4-5-14-28-25(26)27/h2-3,6,8-11,17,20,23H,5,12-16H2,1H3,(H,29,30)(H4,26,27,28) |
| InChIKey | VPPTUBIYXARTBR-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 105.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.56 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|