C25H34N4OS — CID 66836172
5-[3-[1H-benzimidazol-2-yl-(1-methylpiperidin-4-yl)oxymethyl]phenyl]sulfanylpentan-1-amine (PubChem CID 66836172) has the molecular formula C25H34N4OS and a molecular weight of 438.64 g/mol. Its IUPAC name is 5-[3-[1H-benzimidazol-2-yl-(1-methylpiperidin-4-yl)oxymethyl]phenyl]sulfanylpentan-1-amine.
| Compound Name | 5-[3-[1H-benzimidazol-2-yl-(1-methylpiperidin-4-yl)oxymethyl]phenyl]sulfanylpentan-1-amine |
|---|---|
| PubChem CID | 66836172 |
| Molecular Formula | C25H34N4OS |
| Molecular Weight | 438.64 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | 5-[3-[1H-benzimidazol-2-yl-(1-methylpiperidin-4-yl)oxymethyl]phenyl]sulfanylpentan-1-amine |
| SMILES | CN1CCC(OC(c2cccc(SCCCCCN)c2)c2nc3ccccc3[nH]2)CC1 |
| InChI | InChI=1S/C25H34N4OS/c1-29-15-12-20(13-16-29)30-24(25-27-22-10-3-4-11-23(22)28-25)19-8-7-9-21(18-19)31-17-6-2-5-14-26/h3-4,7-11,18,20,24H,2,5-6,12-17,26H2,1H3,(H,27,28) |
| InChIKey | WFZJTWKUQHQPTF-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.64 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|