C26H29N5O3S — CID 87173899
3-amino-4-[2-[3-[1H-benzimidazol-2-yl-(1-methylpiperidin-4-yl)oxymethyl]phenyl]sulfanylethylamino]cyclobut-3-ene-1,2-dione (PubChem CID 87173899) has the molecular formula C26H29N5O3S and a molecular weight of 491.62 g/mol. Its IUPAC name is 3-amino-4-[2-[3-[1H-benzimidazol-2-yl-(1-methylpiperidin-4-yl)oxymethyl]phenyl]sulfanylethylamino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-amino-4-[2-[3-[1H-benzimidazol-2-yl-(1-methylpiperidin-4-yl)oxymethyl]phenyl]sulfanylethylamino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 87173899 |
| Molecular Formula | C26H29N5O3S |
| Molecular Weight | 491.62 g/mol |
| Exact Mass | 491.20 |
| IUPAC Name | 3-amino-4-[2-[3-[1H-benzimidazol-2-yl-(1-methylpiperidin-4-yl)oxymethyl]phenyl]sulfanylethylamino]cyclobut-3-ene-1,2-dione |
| SMILES | CN1CCC(OC(c2cccc(SCCNc3c(N)c(=O)c3=O)c2)c2nc3ccccc3[nH]2)CC1 |
| InChI | InChI=1S/C26H29N5O3S/c1-31-12-9-17(10-13-31)34-25(26-29-19-7-2-3-8-20(19)30-26)16-5-4-6-18(15-16)35-14-11-28-22-21(27)23(32)24(22)33/h2-8,15,17,25,28H,9-14,27H2,1H3,(H,29,30) |
| InChIKey | SEJUCXJAQVMDEG-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 113.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.62 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|