C23H29N3OS — CID 67512953
2-[(3-ethylsulfanyl-4-methylphenyl)-(1-methylpiperidin-4-yl)oxymethyl]-1H-benzimidazole (PubChem CID 67512953) has the molecular formula C23H29N3OS and a molecular weight of 395.57 g/mol. Its IUPAC name is 2-[(3-ethylsulfanyl-4-methylphenyl)-(1-methylpiperidin-4-yl)oxymethyl]-1H-benzimidazole.
| Compound Name | 2-[(3-ethylsulfanyl-4-methylphenyl)-(1-methylpiperidin-4-yl)oxymethyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 67512953 |
| Molecular Formula | C23H29N3OS |
| Molecular Weight | 395.57 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | 2-[(3-ethylsulfanyl-4-methylphenyl)-(1-methylpiperidin-4-yl)oxymethyl]-1H-benzimidazole |
| SMILES | CCSc1cc(C(OC2CCN(C)CC2)c2nc3ccccc3[nH]2)ccc1C |
| InChI | InChI=1S/C23H29N3OS/c1-4-28-21-15-17(10-9-16(21)2)22(27-18-11-13-26(3)14-12-18)23-24-19-7-5-6-8-20(19)25-23/h5-10,15,18,22H,4,11-14H2,1-3H3,(H,24,25) |
| InChIKey | WVNVBBPNMBMHCS-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 41.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.57 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |