C24H32N6O — CID 67512169
2-[3-[3-[1H-benzimidazol-2-yl-(1-methylpiperidin-4-yl)oxymethyl]phenyl]propyl]guanidine (PubChem CID 67512169) has the molecular formula C24H32N6O and a molecular weight of 420.56 g/mol. Its IUPAC name is 2-[3-[3-[1H-benzimidazol-2-yl-(1-methylpiperidin-4-yl)oxymethyl]phenyl]propyl]guanidine.
| Compound Name | 2-[3-[3-[1H-benzimidazol-2-yl-(1-methylpiperidin-4-yl)oxymethyl]phenyl]propyl]guanidine |
|---|---|
| PubChem CID | 67512169 |
| Molecular Formula | C24H32N6O |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.26 |
| IUPAC Name | 2-[3-[3-[1H-benzimidazol-2-yl-(1-methylpiperidin-4-yl)oxymethyl]phenyl]propyl]guanidine |
| SMILES | CN1CCC(OC(c2cccc(CCCN=C(N)N)c2)c2nc3ccccc3[nH]2)CC1 |
| InChI | InChI=1S/C24H32N6O/c1-30-14-11-19(12-15-30)31-22(23-28-20-9-2-3-10-21(20)29-23)18-8-4-6-17(16-18)7-5-13-27-24(25)26/h2-4,6,8-10,16,19,22H,5,7,11-15H2,1H3,(H,28,29)(H4,25,26,27) |
| InChIKey | HYZMMMRJWQUTTP-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 105.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|