C30H42N6O3 — CID 118162296
tert-butyl N-[4-[3-[1H-benzimidazol-2-yl-(1-methylpiperidin-4-yl)oxymethyl]phenyl]butyl]-N-carbamimidoylcarbamate (PubChem CID 118162296) has the molecular formula C30H42N6O3 and a molecular weight of 534.71 g/mol. Its IUPAC name is tert-butyl N-[4-[3-[1H-benzimidazol-2-yl-(1-methylpiperidin-4-yl)oxymethyl]phenyl]butyl]-N-carbamimidoylcarbamate.
| Compound Name | tert-butyl N-[4-[3-[1H-benzimidazol-2-yl-(1-methylpiperidin-4-yl)oxymethyl]phenyl]butyl]-N-carbamimidoylcarbamate |
|---|---|
| PubChem CID | 118162296 |
| Molecular Formula | C30H42N6O3 |
| Molecular Weight | 534.71 g/mol |
| Exact Mass | 534.33 |
| IUPAC Name | tert-butyl N-[4-[3-[1H-benzimidazol-2-yl-(1-methylpiperidin-4-yl)oxymethyl]phenyl]butyl]-N-carbamimidoylcarbamate |
| SMILES | [H]/N=C(\N)N(CCCCc1cccc(C(OC2CCN(C)CC2)c2nc3ccccc3[nH]2)c1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H42N6O3/c1-30(2,3)39-29(37)36(28(31)32)17-8-7-10-21-11-9-12-22(20-21)26(38-23-15-18-35(4)19-16-23)27-33-24-13-5-6-14-25(24)34-27/h5-6,9,11-14,20,23,26H,7-8,10,15-19H2,1-4H3,(H3,31,32)(H,33,34) |
| InChIKey | VZDCKGZTEDPJBM-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 120.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.71 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|