C25H31ClN2O — CID 72694724
6-[3-[(4-chlorophenyl)-(1-methylpiperidin-4-yl)oxymethyl]phenyl]hex-5-yn-1-amine (PubChem CID 72694724) has the molecular formula C25H31ClN2O and a molecular weight of 410.99 g/mol. Its IUPAC name is 6-[3-[(4-chlorophenyl)-(1-methylpiperidin-4-yl)oxymethyl]phenyl]hex-5-yn-1-amine.
| Compound Name | 6-[3-[(4-chlorophenyl)-(1-methylpiperidin-4-yl)oxymethyl]phenyl]hex-5-yn-1-amine |
|---|---|
| PubChem CID | 72694724 |
| Molecular Formula | C25H31ClN2O |
| Molecular Weight | 410.99 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | 6-[3-[(4-chlorophenyl)-(1-methylpiperidin-4-yl)oxymethyl]phenyl]hex-5-yn-1-amine |
| SMILES | CN1CCC(OC(c2ccc(Cl)cc2)c2cccc(C#CCCCCN)c2)CC1 |
| InChI | InChI=1S/C25H31ClN2O/c1-28-17-14-24(15-18-28)29-25(21-10-12-23(26)13-11-21)22-9-6-8-20(19-22)7-4-2-3-5-16-27/h6,8-13,19,24-25H,2-3,5,14-18,27H2,1H3 |
| InChIKey | FDONGUCPVOJPSF-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.99 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|