C32H33N3O3 — CID 86703871
2-[6-[3-[(1-methylpiperidin-4-yl)oxy-pyridin-2-ylmethyl]phenyl]hex-5-ynyl]isoindole-1,3-dione (PubChem CID 86703871) has the molecular formula C32H33N3O3 and a molecular weight of 507.63 g/mol. Its IUPAC name is 2-[6-[3-[(1-methylpiperidin-4-yl)oxy-pyridin-2-ylmethyl]phenyl]hex-5-ynyl]isoindole-1,3-dione.
| Compound Name | 2-[6-[3-[(1-methylpiperidin-4-yl)oxy-pyridin-2-ylmethyl]phenyl]hex-5-ynyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 86703871 |
| Molecular Formula | C32H33N3O3 |
| Molecular Weight | 507.63 g/mol |
| Exact Mass | 507.25 |
| IUPAC Name | 2-[6-[3-[(1-methylpiperidin-4-yl)oxy-pyridin-2-ylmethyl]phenyl]hex-5-ynyl]isoindole-1,3-dione |
| SMILES | CN1CCC(OC(c2cccc(C#CCCCCN3C(=O)c4ccccc4C3=O)c2)c2ccccn2)CC1 |
| InChI | InChI=1S/C32H33N3O3/c1-34-21-17-26(18-22-34)38-30(29-16-7-8-19-33-29)25-13-10-12-24(23-25)11-4-2-3-9-20-35-31(36)27-14-5-6-15-28(27)32(35)37/h5-8,10,12-16,19,23,26,30H,2-3,9,17-18,20-22H2,1H3 |
| InChIKey | HJUGOJQKUAMRTL-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.63 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|