C19H14BrNO2 — CID 67203127
2-[5-(3-bromophenyl)pent-4-ynyl]isoindole-1,3-dione (PubChem CID 67203127) has the molecular formula C19H14BrNO2 and a molecular weight of 368.23 g/mol. Its IUPAC name is 2-[5-(3-bromophenyl)pent-4-ynyl]isoindole-1,3-dione.
| Compound Name | 2-[5-(3-bromophenyl)pent-4-ynyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 67203127 |
| Molecular Formula | C19H14BrNO2 |
| Molecular Weight | 368.23 g/mol |
| Exact Mass | 367.02 |
| IUPAC Name | 2-[5-(3-bromophenyl)pent-4-ynyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCCC#Cc1cccc(Br)c1 |
| InChI | InChI=1S/C19H14BrNO2/c20-15-9-6-8-14(13-15)7-2-1-5-12-21-18(22)16-10-3-4-11-17(16)19(21)23/h3-4,6,8-11,13H,1,5,12H2 |
| InChIKey | NLVOGNMPUWQDKT-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.23 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|