[4-[4-(1,3-dioxoisoindol-2-yl)but-1-ynyl]phenyl]boronic acid

C18H14BNO4 — CID 162705716

IUPAC[4-[4-(1,3-dioxoisoindol-2-yl)but-1-ynyl]phenyl]boronic acid
SMILESO=C1c2ccccc2C(=O)N1CCC#Cc1ccc(B(O)O)cc1
InChIInChI=1S/C18H14BNO4/c21-17-15-6-1-2-7-16(15)18(22)20(17)12-4-3-5-13-8-10-14(11-9-13)19(23)24/h1-2,6-11,23-24H,4,12H2
InChIKeyHSABMCUQYRQNGL-UHFFFAOYSA-N
MW319.13 g/mol
LogP0.40
Rot. Bonds3

About [4-[4-(1,3-dioxoisoindol-2-yl)but-1-ynyl]phenyl]boronic acid

[4-[4-(1,3-dioxoisoindol-2-yl)but-1-ynyl]phenyl]boronic acid (PubChem CID 162705716) has the molecular formula C18H14BNO4 and a molecular weight of 319.13 g/mol. Its IUPAC name is [4-[4-(1,3-dioxoisoindol-2-yl)but-1-ynyl]phenyl]boronic acid.

Molecular Properties

Compound Name[4-[4-(1,3-dioxoisoindol-2-yl)but-1-ynyl]phenyl]boronic acid
PubChem CID162705716
Molecular FormulaC18H14BNO4
Molecular Weight319.13 g/mol
Exact Mass319.10
IUPAC Name[4-[4-(1,3-dioxoisoindol-2-yl)but-1-ynyl]phenyl]boronic acid
SMILESO=C1c2ccccc2C(=O)N1CCC#Cc1ccc(B(O)O)cc1
InChIInChI=1S/C18H14BNO4/c21-17-15-6-1-2-7-16(15)18(22)20(17)12-4-3-5-13-8-10-14(11-9-13)19(23)24/h1-2,6-11,23-24H,4,12H2
InChIKeyHSABMCUQYRQNGL-UHFFFAOYSA-N
XLogP0.40
TPSA77.84 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms24
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500319.13
LogP ≤ 50.40
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'}

Analyze [4-[4-(1,3-dioxoisoindol-2-yl)but-1-ynyl]phenyl]boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [4-[4-(1,3-dioxoisoindol-2-yl)but-1-ynyl]phenyl]boronic acid?
The IUPAC name of [4-[4-(1,3-dioxoisoindol-2-yl)but-1-ynyl]phenyl]boronic acid (CID 162705716) is [4-[4-(1,3-dioxoisoindol-2-yl)but-1-ynyl]phenyl]boronic acid.
What is the SMILES notation for [4-[4-(1,3-dioxoisoindol-2-yl)but-1-ynyl]phenyl]boronic acid?
The canonical SMILES for [4-[4-(1,3-dioxoisoindol-2-yl)but-1-ynyl]phenyl]boronic acid is O=C1c2ccccc2C(=O)N1CCC#Cc1ccc(B(O)O)cc1.
What is the InChIKey of [4-[4-(1,3-dioxoisoindol-2-yl)but-1-ynyl]phenyl]boronic acid?
The InChIKey is HSABMCUQYRQNGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14BNO4/c21-17-15-6-1-2-7-16(15)18(22)20(17)12-4-3-5-13-8-10-14(11-9-13)19(23)24/h1-2,6-11,23-24H,4,12H2.
What are the key properties of [4-[4-(1,3-dioxoisoindol-2-yl)but-1-ynyl]phenyl]boronic acid?
[4-[4-(1,3-dioxoisoindol-2-yl)but-1-ynyl]phenyl]boronic acid has a molecular weight of 319.13 g/mol, XLogP of 0.40, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[4-(1,3-dioxoisoindol-2-yl)but-1-ynyl]phenyl]boronic acid is sourced from PubChem (CID 162705716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).