C18H14BNO4 — CID 162705716
[4-[4-(1,3-dioxoisoindol-2-yl)but-1-ynyl]phenyl]boronic acid (PubChem CID 162705716) has the molecular formula C18H14BNO4 and a molecular weight of 319.13 g/mol. Its IUPAC name is [4-[4-(1,3-dioxoisoindol-2-yl)but-1-ynyl]phenyl]boronic acid.
| Compound Name | [4-[4-(1,3-dioxoisoindol-2-yl)but-1-ynyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 162705716 |
| Molecular Formula | C18H14BNO4 |
| Molecular Weight | 319.13 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | [4-[4-(1,3-dioxoisoindol-2-yl)but-1-ynyl]phenyl]boronic acid |
| SMILES | O=C1c2ccccc2C(=O)N1CCC#Cc1ccc(B(O)O)cc1 |
| InChI | InChI=1S/C18H14BNO4/c21-17-15-6-1-2-7-16(15)18(22)20(17)12-4-3-5-13-8-10-14(11-9-13)19(23)24/h1-2,6-11,23-24H,4,12H2 |
| InChIKey | HSABMCUQYRQNGL-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.13 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|