C17H12N2O3S — CID 167013849
2-[4-[5-(hydroxyiminomethyl)thiophen-2-yl]but-3-ynyl]isoindole-1,3-dione (PubChem CID 167013849) has the molecular formula C17H12N2O3S and a molecular weight of 324.36 g/mol. Its IUPAC name is 2-[4-[5-(hydroxyiminomethyl)thiophen-2-yl]but-3-ynyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[5-(hydroxyiminomethyl)thiophen-2-yl]but-3-ynyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 167013849 |
| Molecular Formula | C17H12N2O3S |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | 2-[4-[5-(hydroxyiminomethyl)thiophen-2-yl]but-3-ynyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCC#Cc1ccc(C=NO)s1 |
| InChI | InChI=1S/C17H12N2O3S/c20-16-14-6-1-2-7-15(14)17(21)19(16)10-4-3-5-12-8-9-13(23-12)11-18-22/h1-2,6-9,11,22H,4,10H2 |
| InChIKey | FNNAWMHHPZGZHR-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|