C29H26N4O2S — CID 168613271
benzyl N'-[[2-[6-(1,3-dioxoisoindol-2-yl)hex-1-ynyl]phenyl]methylideneamino]carbamimidothioate (PubChem CID 168613271) has the molecular formula C29H26N4O2S and a molecular weight of 494.62 g/mol. Its IUPAC name is benzyl N'-[[2-[6-(1,3-dioxoisoindol-2-yl)hex-1-ynyl]phenyl]methylideneamino]carbamimidothioate.
| Compound Name | benzyl N'-[[2-[6-(1,3-dioxoisoindol-2-yl)hex-1-ynyl]phenyl]methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 168613271 |
| Molecular Formula | C29H26N4O2S |
| Molecular Weight | 494.62 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | benzyl N'-[[2-[6-(1,3-dioxoisoindol-2-yl)hex-1-ynyl]phenyl]methylideneamino]carbamimidothioate |
| SMILES | NC(=NN=Cc1ccccc1C#CCCCCN1C(=O)c2ccccc2C1=O)SCc1ccccc1 |
| InChI | InChI=1S/C29H26N4O2S/c30-29(36-21-22-12-4-3-5-13-22)32-31-20-24-16-8-7-15-23(24)14-6-1-2-11-19-33-27(34)25-17-9-10-18-26(25)28(33)35/h3-5,7-10,12-13,15-18,20H,1-2,11,19,21H2,(H2,30,32) |
| InChIKey | NVNKUPNMEQGSQD-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 88.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.62 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|