C20H16N2O4 — CID 20598527
methyl N-[2-[4-(1,3-dioxoisoindol-2-yl)but-1-ynyl]phenyl]carbamate (PubChem CID 20598527) has the molecular formula C20H16N2O4 and a molecular weight of 348.36 g/mol. Its IUPAC name is methyl N-[2-[4-(1,3-dioxoisoindol-2-yl)but-1-ynyl]phenyl]carbamate.
| Compound Name | methyl N-[2-[4-(1,3-dioxoisoindol-2-yl)but-1-ynyl]phenyl]carbamate |
|---|---|
| PubChem CID | 20598527 |
| Molecular Formula | C20H16N2O4 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | methyl N-[2-[4-(1,3-dioxoisoindol-2-yl)but-1-ynyl]phenyl]carbamate |
| SMILES | COC(=O)Nc1ccccc1C#CCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C20H16N2O4/c1-26-20(25)21-17-12-5-2-8-14(17)9-6-7-13-22-18(23)15-10-3-4-11-16(15)19(22)24/h2-5,8,10-12H,7,13H2,1H3,(H,21,25) |
| InChIKey | YNJNTSBWUVZUAH-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|