About methyl N-[2-[4-(1,3-dioxoisoindol-2-yl)but-1-ynyl]phenyl]carbamate
methyl N-[2-[4-(1,3-dioxoisoindol-2-yl)but-1-ynyl]phenyl]carbamate (PubChem CID 20598527) has the molecular formula C20H16N2O4
and a molecular weight of 348.36 g/mol. Its IUPAC name is methyl N-[2-[4-(1,3-dioxoisoindol-2-yl)but-1-ynyl]phenyl]carbamate.
Molecular Properties
| Compound Name | methyl N-[2-[4-(1,3-dioxoisoindol-2-yl)but-1-ynyl]phenyl]carbamate |
| PubChem CID | 20598527 |
| Molecular Formula | C20H16N2O4 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | methyl N-[2-[4-(1,3-dioxoisoindol-2-yl)but-1-ynyl]phenyl]carbamate |
| SMILES | COC(=O)Nc1ccccc1C#CCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C20H16N2O4/c1-26-20(25)21-17-12-5-2-8-14(17)9-6-7-13-22-18(23)15-10-3-4-11-16(15)19(22)24/h2-5,8,10-12H,7,13H2,1H3,(H,21,25) |
| InChIKey | YNJNTSBWUVZUAH-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl N-[2-[4-(1,3-dioxoisoindol-2-yl)but-1-ynyl]phenyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[2-[4-(1,3-dioxoisoindol-2-yl)but-1-ynyl]phenyl]carbamate?
The IUPAC name of methyl N-[2-[4-(1,3-dioxoisoindol-2-yl)but-1-ynyl]phenyl]carbamate (CID 20598527) is methyl N-[2-[4-(1,3-dioxoisoindol-2-yl)but-1-ynyl]phenyl]carbamate.
What is the SMILES notation for methyl N-[2-[4-(1,3-dioxoisoindol-2-yl)but-1-ynyl]phenyl]carbamate?
The canonical SMILES for methyl N-[2-[4-(1,3-dioxoisoindol-2-yl)but-1-ynyl]phenyl]carbamate is COC(=O)Nc1ccccc1C#CCCN1C(=O)c2ccccc2C1=O.
What is the InChIKey of methyl N-[2-[4-(1,3-dioxoisoindol-2-yl)but-1-ynyl]phenyl]carbamate?
The InChIKey is YNJNTSBWUVZUAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16N2O4/c1-26-20(25)21-17-12-5-2-8-14(17)9-6-7-13-22-18(23)15-10-3-4-11-16(15)19(22)24/h2-5,8,10-12H,7,13H2,1H3,(H,21,25).
What are the key properties of methyl N-[2-[4-(1,3-dioxoisoindol-2-yl)but-1-ynyl]phenyl]carbamate?
methyl N-[2-[4-(1,3-dioxoisoindol-2-yl)but-1-ynyl]phenyl]carbamate has a molecular weight of 348.36 g/mol, XLogP of 2.90, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[2-[4-(1,3-dioxoisoindol-2-yl)but-1-ynyl]phenyl]carbamate is sourced from PubChem (CID 20598527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).