C28H30N2O5 — CID 67203241
tert-butyl 4-[3-[4-(1,3-dioxoisoindol-2-yl)but-1-ynyl]phenoxy]piperidine-1-carboxylate (PubChem CID 67203241) has the molecular formula C28H30N2O5 and a molecular weight of 474.56 g/mol. Its IUPAC name is tert-butyl 4-[3-[4-(1,3-dioxoisoindol-2-yl)but-1-ynyl]phenoxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[4-(1,3-dioxoisoindol-2-yl)but-1-ynyl]phenoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 67203241 |
| Molecular Formula | C28H30N2O5 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | tert-butyl 4-[3-[4-(1,3-dioxoisoindol-2-yl)but-1-ynyl]phenoxy]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Oc2cccc(C#CCCN3C(=O)c4ccccc4C3=O)c2)CC1 |
| InChI | InChI=1S/C28H30N2O5/c1-28(2,3)35-27(33)29-17-14-21(15-18-29)34-22-11-8-10-20(19-22)9-6-7-16-30-25(31)23-12-4-5-13-24(23)26(30)32/h4-5,8,10-13,19,21H,7,14-18H2,1-3H3 |
| InChIKey | ULXJTGFTSPIHEB-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|