C20H21FN4O2 — CID 157448648
N-[3-(cyclopentylmethoxy)-1-methylindazol-6-yl]-4-fluoropyridine-2-carboxamide (PubChem CID 157448648) has the molecular formula C20H21FN4O2 and a molecular weight of 368.41 g/mol. Its IUPAC name is N-[3-(cyclopentylmethoxy)-1-methylindazol-6-yl]-4-fluoropyridine-2-carboxamide.
| Compound Name | N-[3-(cyclopentylmethoxy)-1-methylindazol-6-yl]-4-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 157448648 |
| Molecular Formula | C20H21FN4O2 |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | N-[3-(cyclopentylmethoxy)-1-methylindazol-6-yl]-4-fluoropyridine-2-carboxamide |
| SMILES | Cn1nc(OCC2CCCC2)c2ccc(NC(=O)c3cc(F)ccn3)cc21 |
| InChI | InChI=1S/C20H21FN4O2/c1-25-18-11-15(23-19(26)17-10-14(21)8-9-22-17)6-7-16(18)20(24-25)27-12-13-4-2-3-5-13/h6-11,13H,2-5,12H2,1H3,(H,23,26) |
| InChIKey | RSKBBEXUFAELAK-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |