C21H17F2N5O3 — CID 157455453
1-[6-(2,2-difluoroethyl)-1,3-dihydropyrrolo[3,4-c]pyridin-2-yl]-2-(3-nitro-6-pyridin-3-yl-2-pyridinyl)ethanone (PubChem CID 157455453) has the molecular formula C21H17F2N5O3 and a molecular weight of 425.40 g/mol. Its IUPAC name is 1-[6-(2,2-difluoroethyl)-1,3-dihydropyrrolo[3,4-c]pyridin-2-yl]-2-(3-nitro-6-pyridin-3-yl-2-pyridinyl)ethanone.
| Compound Name | 1-[6-(2,2-difluoroethyl)-1,3-dihydropyrrolo[3,4-c]pyridin-2-yl]-2-(3-nitro-6-pyridin-3-yl-2-pyridinyl)ethanone |
|---|---|
| PubChem CID | 157455453 |
| Molecular Formula | C21H17F2N5O3 |
| Molecular Weight | 425.40 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | 1-[6-(2,2-difluoroethyl)-1,3-dihydropyrrolo[3,4-c]pyridin-2-yl]-2-(3-nitro-6-pyridin-3-yl-2-pyridinyl)ethanone |
| SMILES | O=C(Cc1nc(-c2cccnc2)ccc1[N+](=O)[O-])N1Cc2cnc(CC(F)F)cc2C1 |
| InChI | InChI=1S/C21H17F2N5O3/c22-20(23)7-16-6-14-11-27(12-15(14)10-25-16)21(29)8-18-19(28(30)31)4-3-17(26-18)13-2-1-5-24-9-13/h1-6,9-10,20H,7-8,11-12H2 |
| InChIKey | SBWNJBNBRIHVQL-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 102.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.40 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|