C22H22F6N2O3S — CID 157457567
2-[5-(cyclopropylmethyl-methylidene-oxo-λ6-sulfanyl)-2-pyridinyl]-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3-methylphenyl]acetamide (PubChem CID 157457567) has the molecular formula C22H22F6N2O3S and a molecular weight of 508.48 g/mol. Its IUPAC name is 2-[5-(cyclopropylmethyl-methylidene-oxo-λ6-sulfanyl)-2-pyridinyl]-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3-methylphenyl]acetamide.
| Compound Name | 2-[5-(cyclopropylmethyl-methylidene-oxo-λ6-sulfanyl)-2-pyridinyl]-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3-methylphenyl]acetamide |
|---|---|
| PubChem CID | 157457567 |
| Molecular Formula | C22H22F6N2O3S |
| Molecular Weight | 508.48 g/mol |
| Exact Mass | 508.13 |
| IUPAC Name | 2-[5-(cyclopropylmethyl-methylidene-oxo-λ6-sulfanyl)-2-pyridinyl]-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3-methylphenyl]acetamide |
| SMILES | C=S(=O)(CC1CC1)c1ccc(CC(=O)Nc2ccc(C(O)(C(F)(F)F)C(F)(F)F)c(C)c2)nc1 |
| InChI | InChI=1S/C22H22F6N2O3S/c1-13-9-16(6-8-18(13)20(32,21(23,24)25)22(26,27)28)30-19(31)10-15-5-7-17(11-29-15)34(2,33)12-14-3-4-14/h5-9,11,14,32H,2-4,10,12H2,1H3,(H,30,31) |
| InChIKey | XZWBHIYHJYNFMA-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.48 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|