C25H22FNO3 — CID 157459389
5-[2-(4-fluoro-2,6-dimethylphenoxy)-6-(2-oxobut-3-ynyl)phenyl]-1,4-dimethylpyridin-2-one (PubChem CID 157459389) has the molecular formula C25H22FNO3 and a molecular weight of 403.45 g/mol. Its IUPAC name is 5-[2-(4-fluoro-2,6-dimethylphenoxy)-6-(2-oxobut-3-ynyl)phenyl]-1,4-dimethylpyridin-2-one.
| Compound Name | 5-[2-(4-fluoro-2,6-dimethylphenoxy)-6-(2-oxobut-3-ynyl)phenyl]-1,4-dimethylpyridin-2-one |
|---|---|
| PubChem CID | 157459389 |
| Molecular Formula | C25H22FNO3 |
| Molecular Weight | 403.45 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 5-[2-(4-fluoro-2,6-dimethylphenoxy)-6-(2-oxobut-3-ynyl)phenyl]-1,4-dimethylpyridin-2-one |
| SMILES | C#CC(=O)Cc1cccc(Oc2c(C)cc(F)cc2C)c1-c1cn(C)c(=O)cc1C |
| InChI | InChI=1S/C25H22FNO3/c1-6-20(28)13-18-8-7-9-22(30-25-16(3)10-19(26)11-17(25)4)24(18)21-14-27(5)23(29)12-15(21)2/h1,7-12,14H,13H2,2-5H3 |
| InChIKey | BTTAKFHUFODEHP-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.45 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|