About 2-[4-bromo-5-(4-fluoro-2,6-dimethylphenoxy)-2-oxo-1-pyridinyl]-N,N-dimethylacetamide
2-[4-bromo-5-(4-fluoro-2,6-dimethylphenoxy)-2-oxo-1-pyridinyl]-N,N-dimethylacetamide (PubChem CID 175723620) has the molecular formula C17H18BrFN2O3
and a molecular weight of 397.24 g/mol. Its IUPAC name is 2-[4-bromo-5-(4-fluoro-2,6-dimethylphenoxy)-2-oxo-1-pyridinyl]-N,N-dimethylacetamide.
Molecular Properties
| Compound Name | 2-[4-bromo-5-(4-fluoro-2,6-dimethylphenoxy)-2-oxo-1-pyridinyl]-N,N-dimethylacetamide |
| PubChem CID | 175723620 |
| Molecular Formula | C17H18BrFN2O3 |
| Molecular Weight | 397.24 g/mol |
| Exact Mass | 396.05 |
| IUPAC Name | 2-[4-bromo-5-(4-fluoro-2,6-dimethylphenoxy)-2-oxo-1-pyridinyl]-N,N-dimethylacetamide |
| SMILES | Cc1cc(F)cc(C)c1Oc1cn(CC(=O)N(C)C)c(=O)cc1Br |
| InChI | InChI=1S/C17H18BrFN2O3/c1-10-5-12(19)6-11(2)17(10)24-14-8-21(9-16(23)20(3)4)15(22)7-13(14)18/h5-8H,9H2,1-4H3 |
| InChIKey | CBQRNOGTXTWFTN-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.24 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[4-bromo-5-(4-fluoro-2,6-dimethylphenoxy)-2-oxo-1-pyridinyl]-N,N-dimethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-bromo-5-(4-fluoro-2,6-dimethylphenoxy)-2-oxo-1-pyridinyl]-N,N-dimethylacetamide?
The IUPAC name of 2-[4-bromo-5-(4-fluoro-2,6-dimethylphenoxy)-2-oxo-1-pyridinyl]-N,N-dimethylacetamide (CID 175723620) is 2-[4-bromo-5-(4-fluoro-2,6-dimethylphenoxy)-2-oxo-1-pyridinyl]-N,N-dimethylacetamide.
What is the SMILES notation for 2-[4-bromo-5-(4-fluoro-2,6-dimethylphenoxy)-2-oxo-1-pyridinyl]-N,N-dimethylacetamide?
The canonical SMILES for 2-[4-bromo-5-(4-fluoro-2,6-dimethylphenoxy)-2-oxo-1-pyridinyl]-N,N-dimethylacetamide is Cc1cc(F)cc(C)c1Oc1cn(CC(=O)N(C)C)c(=O)cc1Br.
What is the InChIKey of 2-[4-bromo-5-(4-fluoro-2,6-dimethylphenoxy)-2-oxo-1-pyridinyl]-N,N-dimethylacetamide?
The InChIKey is CBQRNOGTXTWFTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18BrFN2O3/c1-10-5-12(19)6-11(2)17(10)24-14-8-21(9-16(23)20(3)4)15(22)7-13(14)18/h5-8H,9H2,1-4H3.
What are the key properties of 2-[4-bromo-5-(4-fluoro-2,6-dimethylphenoxy)-2-oxo-1-pyridinyl]-N,N-dimethylacetamide?
2-[4-bromo-5-(4-fluoro-2,6-dimethylphenoxy)-2-oxo-1-pyridinyl]-N,N-dimethylacetamide has a molecular weight of 397.24 g/mol, XLogP of 3.25, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-bromo-5-(4-fluoro-2,6-dimethylphenoxy)-2-oxo-1-pyridinyl]-N,N-dimethylacetamide is sourced from PubChem (CID 175723620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).