C41H69NO9 — CID 157460574
(5-cyano-2-bicyclo[2.2.1]heptanyl) 2,2-dimethylbutanoate;(1-ethyl-3,3,5-trimethylcyclohexyl) 2,2-dimethylbutanoate;(2-oxo-1,3-dioxolan-4-yl)methyl 2,2-dimethylbutanoate (PubChem CID 157460574) has the molecular formula C41H69NO9 and a molecular weight of 720.00 g/mol. Its IUPAC name is (5-cyano-2-bicyclo[2.2.1]heptanyl) 2,2-dimethylbutanoate;(1-ethyl-3,3,5-trimethylcyclohexyl) 2,2-dimethylbutanoate;(2-oxo-1,3-dioxolan-4-yl)methyl 2,2-dimethylbutanoate.
| Compound Name | (5-cyano-2-bicyclo[2.2.1]heptanyl) 2,2-dimethylbutanoate;(1-ethyl-3,3,5-trimethylcyclohexyl) 2,2-dimethylbutanoate;(2-oxo-1,3-dioxolan-4-yl)methyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 157460574 |
| Molecular Formula | C41H69NO9 |
| Molecular Weight | 720.00 g/mol |
| Exact Mass | 719.50 |
| IUPAC Name | (5-cyano-2-bicyclo[2.2.1]heptanyl) 2,2-dimethylbutanoate;(1-ethyl-3,3,5-trimethylcyclohexyl) 2,2-dimethylbutanoate;(2-oxo-1,3-dioxolan-4-yl)methyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1CC2CC1CC2C#N.CCC(C)(C)C(=O)OCC1COC(=O)O1.CCC1(OC(=O)C(C)(C)CC)CC(C)CC(C)(C)C1 |
| InChI | InChI=1S/C17H32O2.C14H21NO2.C10H16O5/c1-8-16(6,7)14(18)19-17(9-2)11-13(3)10-15(4,5)12-17;1-4-14(2,3)13(16)17-12-7-9-5-10(12)6-11(9)8-15;1-4-10(2,3)8(11)13-5-7-6-14-9(12)15-7/h13H,8-12H2,1-7H3;9-12H,4-7H2,1-3H3;7H,4-6H2,1-3H3 |
| InChIKey | BTWKQGOLOHWBQW-UHFFFAOYSA-N |
| XLogP | 9.37 |
| TPSA | 138.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.00 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|