C36H36N6O6 — CID 157466186
(2S)-2-amino-3-(5-ethenyl-1H-indol-3-yl)propanoic acid;(2S)-2-amino-3-(5-ethenyl-4-nitro-1H-indol-3-yl)propanoic acid;5-ethenyl-1H-indole (PubChem CID 157466186) has the molecular formula C36H36N6O6 and a molecular weight of 648.72 g/mol. Its IUPAC name is (2S)-2-amino-3-(5-ethenyl-1H-indol-3-yl)propanoic acid;(2S)-2-amino-3-(5-ethenyl-4-nitro-1H-indol-3-yl)propanoic acid;5-ethenyl-1H-indole.
| Compound Name | (2S)-2-amino-3-(5-ethenyl-1H-indol-3-yl)propanoic acid;(2S)-2-amino-3-(5-ethenyl-4-nitro-1H-indol-3-yl)propanoic acid;5-ethenyl-1H-indole |
|---|---|
| PubChem CID | 157466186 |
| Molecular Formula | C36H36N6O6 |
| Molecular Weight | 648.72 g/mol |
| Exact Mass | 648.27 |
| IUPAC Name | (2S)-2-amino-3-(5-ethenyl-1H-indol-3-yl)propanoic acid;(2S)-2-amino-3-(5-ethenyl-4-nitro-1H-indol-3-yl)propanoic acid;5-ethenyl-1H-indole |
| SMILES | C=Cc1ccc2[nH]cc(C[C@H](N)C(=O)O)c2c1.C=Cc1ccc2[nH]cc(C[C@H](N)C(=O)O)c2c1[N+](=O)[O-].C=Cc1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C13H13N3O4.C13H14N2O2.C10H9N/c1-2-7-3-4-10-11(12(7)16(19)20)8(6-15-10)5-9(14)13(17)18;1-2-8-3-4-12-10(5-8)9(7-15-12)6-11(14)13(16)17;1-2-8-3-4-10-9(7-8)5-6-11-10/h2-4,6,9,15H,1,5,14H2,(H,17,18);2-5,7,11,15H,1,6,14H2,(H,16,17);2-7,11H,1H2/t9-;11-;/m00./s1 |
| InChIKey | BUMVLGMDYIEMKH-VHVBEMAOSA-N |
| XLogP | 6.25 |
| TPSA | 217.15 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.72 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|