C12H28O2 — CID 157467331
2,3-dimethylbutan-2-ol;2,3-dimethylbut-2-ene;hydrate (PubChem CID 157467331) has the molecular formula C12H28O2 and a molecular weight of 204.35 g/mol. Its IUPAC name is 2,3-dimethylbutan-2-ol;2,3-dimethylbut-2-ene;hydrate.
| Compound Name | 2,3-dimethylbutan-2-ol;2,3-dimethylbut-2-ene;hydrate |
|---|---|
| PubChem CID | 157467331 |
| Molecular Formula | C12H28O2 |
| Molecular Weight | 204.35 g/mol |
| Exact Mass | 204.21 |
| IUPAC Name | 2,3-dimethylbutan-2-ol;2,3-dimethylbut-2-ene;hydrate |
| SMILES | CC(C)=C(C)C.CC(C)C(C)(C)O.O |
| InChI | InChI=1S/C6H14O.C6H12.H2O/c1-5(2)6(3,4)7;1-5(2)6(3)4;/h5,7H,1-4H3;1-4H3;1H2 |
| InChIKey | FOLITXRVGGMWOD-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 51.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.35 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|