C20H42O6S4 — CID 157468391
1,1,1-triethoxy-3-(4,4,4-triethoxybutan-2-yltetrasulfanyl)butane (PubChem CID 157468391) has the molecular formula C20H42O6S4 and a molecular weight of 506.82 g/mol. Its IUPAC name is 1,1,1-triethoxy-3-(4,4,4-triethoxybutan-2-yltetrasulfanyl)butane.
| Compound Name | 1,1,1-triethoxy-3-(4,4,4-triethoxybutan-2-yltetrasulfanyl)butane |
|---|---|
| PubChem CID | 157468391 |
| Molecular Formula | C20H42O6S4 |
| Molecular Weight | 506.82 g/mol |
| Exact Mass | 506.19 |
| IUPAC Name | 1,1,1-triethoxy-3-(4,4,4-triethoxybutan-2-yltetrasulfanyl)butane |
| SMILES | CCOC(CC(C)SSSSC(C)CC(OCC)(OCC)OCC)(OCC)OCC |
| InChI | InChI=1S/C20H42O6S4/c1-9-21-19(22-10-2,23-11-3)15-17(7)27-29-30-28-18(8)16-20(24-12-4,25-13-5)26-14-6/h17-18H,9-16H2,1-8H3 |
| InChIKey | BUSVRAYYRBSWOI-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.82 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|