C21H27N7O2 — CID 157468493
5-(4-methylanilino)-3-[methyl-[(1R)-3-(prop-2-enoylamino)cyclohexyl]amino]-1,2,4-triazine-6-carboxamide (PubChem CID 157468493) has the molecular formula C21H27N7O2 and a molecular weight of 409.49 g/mol. Its IUPAC name is 5-(4-methylanilino)-3-[methyl-[(1R)-3-(prop-2-enoylamino)cyclohexyl]amino]-1,2,4-triazine-6-carboxamide.
| Compound Name | 5-(4-methylanilino)-3-[methyl-[(1R)-3-(prop-2-enoylamino)cyclohexyl]amino]-1,2,4-triazine-6-carboxamide |
|---|---|
| PubChem CID | 157468493 |
| Molecular Formula | C21H27N7O2 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | 5-(4-methylanilino)-3-[methyl-[(1R)-3-(prop-2-enoylamino)cyclohexyl]amino]-1,2,4-triazine-6-carboxamide |
| SMILES | C=CC(=O)NC1CCC[C@@H](N(C)c2nnc(C(N)=O)c(Nc3ccc(C)cc3)n2)C1 |
| InChI | InChI=1S/C21H27N7O2/c1-4-17(29)23-15-6-5-7-16(12-15)28(3)21-25-20(18(19(22)30)26-27-21)24-14-10-8-13(2)9-11-14/h4,8-11,15-16H,1,5-7,12H2,2-3H3,(H2,22,30)(H,23,29)(H,24,25,27)/t15?,16-/m1/s1 |
| InChIKey | WPRQCGLHUDTPKN-OEMAIJDKSA-N |
| XLogP | 2.07 |
| TPSA | 126.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|