C26H36N8O2 — CID 158655260
5-[4-(1,4-dimethylpiperidin-4-yl)anilino]-3-[[(1R,2R)-2-methyl-3-(prop-2-enoylamino)cyclopentyl]amino]-1,2,4-triazine-6-carboxamide (PubChem CID 158655260) has the molecular formula C26H36N8O2 and a molecular weight of 492.63 g/mol. Its IUPAC name is 5-[4-(1,4-dimethylpiperidin-4-yl)anilino]-3-[[(1R,2R)-2-methyl-3-(prop-2-enoylamino)cyclopentyl]amino]-1,2,4-triazine-6-carboxamide.
| Compound Name | 5-[4-(1,4-dimethylpiperidin-4-yl)anilino]-3-[[(1R,2R)-2-methyl-3-(prop-2-enoylamino)cyclopentyl]amino]-1,2,4-triazine-6-carboxamide |
|---|---|
| PubChem CID | 158655260 |
| Molecular Formula | C26H36N8O2 |
| Molecular Weight | 492.63 g/mol |
| Exact Mass | 492.30 |
| IUPAC Name | 5-[4-(1,4-dimethylpiperidin-4-yl)anilino]-3-[[(1R,2R)-2-methyl-3-(prop-2-enoylamino)cyclopentyl]amino]-1,2,4-triazine-6-carboxamide |
| SMILES | C=CC(=O)NC1CC[C@@H](Nc2nnc(C(N)=O)c(Nc3ccc(C4(C)CCN(C)CC4)cc3)n2)[C@H]1C |
| InChI | InChI=1S/C26H36N8O2/c1-5-21(35)29-19-10-11-20(16(19)2)30-25-31-24(22(23(27)36)32-33-25)28-18-8-6-17(7-9-18)26(3)12-14-34(4)15-13-26/h5-9,16,19-20H,1,10-15H2,2-4H3,(H2,27,36)(H,29,35)(H2,28,30,31,33)/t16-,19?,20+/m0/s1 |
| InChIKey | WDUGGEUROMSIBF-OOFVQCGSSA-N |
| XLogP | 2.58 |
| TPSA | 138.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.63 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|