About 4-methylbenzenethiol;3-(4-methylphenyl)sulfanylpropanal
4-methylbenzenethiol;3-(4-methylphenyl)sulfanylpropanal (PubChem CID 157477931) has the molecular formula C17H20OS2
and a molecular weight of 304.48 g/mol. Its IUPAC name is 4-methylbenzenethiol;3-(4-methylphenyl)sulfanylpropanal.
Molecular Properties
| Compound Name | 4-methylbenzenethiol;3-(4-methylphenyl)sulfanylpropanal |
| PubChem CID | 157477931 |
| Molecular Formula | C17H20OS2 |
| Molecular Weight | 304.48 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 4-methylbenzenethiol;3-(4-methylphenyl)sulfanylpropanal |
| SMILES | Cc1ccc(S)cc1.Cc1ccc(SCCC=O)cc1 |
| InChI | InChI=1S/C10H12OS.C7H8S/c1-9-3-5-10(6-4-9)12-8-2-7-11;1-6-2-4-7(8)5-3-6/h3-7H,2,8H2,1H3;2-5,8H,1H3 |
| InChIKey | BVUWGEMMIDITIG-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.48 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-methylbenzenethiol;3-(4-methylphenyl)sulfanylpropanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylbenzenethiol;3-(4-methylphenyl)sulfanylpropanal?
The IUPAC name of 4-methylbenzenethiol;3-(4-methylphenyl)sulfanylpropanal (CID 157477931) is 4-methylbenzenethiol;3-(4-methylphenyl)sulfanylpropanal.
What is the SMILES notation for 4-methylbenzenethiol;3-(4-methylphenyl)sulfanylpropanal?
The canonical SMILES for 4-methylbenzenethiol;3-(4-methylphenyl)sulfanylpropanal is Cc1ccc(S)cc1.Cc1ccc(SCCC=O)cc1.
What is the InChIKey of 4-methylbenzenethiol;3-(4-methylphenyl)sulfanylpropanal?
The InChIKey is BVUWGEMMIDITIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12OS.C7H8S/c1-9-3-5-10(6-4-9)12-8-2-7-11;1-6-2-4-7(8)5-3-6/h3-7H,2,8H2,1H3;2-5,8H,1H3.
What are the key properties of 4-methylbenzenethiol;3-(4-methylphenyl)sulfanylpropanal?
4-methylbenzenethiol;3-(4-methylphenyl)sulfanylpropanal has a molecular weight of 304.48 g/mol, XLogP of 4.96, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylbenzenethiol;3-(4-methylphenyl)sulfanylpropanal is sourced from PubChem (CID 157477931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).