C18H22N6O2 — CID 157480379
3-(3-aminopropylcarbamoylamino)-N-(2,3-dihydro-1H-inden-2-yl)pyrazine-2-carboxamide (PubChem CID 157480379) has the molecular formula C18H22N6O2 and a molecular weight of 354.41 g/mol. Its IUPAC name is 3-(3-aminopropylcarbamoylamino)-N-(2,3-dihydro-1H-inden-2-yl)pyrazine-2-carboxamide.
| Compound Name | 3-(3-aminopropylcarbamoylamino)-N-(2,3-dihydro-1H-inden-2-yl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 157480379 |
| Molecular Formula | C18H22N6O2 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 3-(3-aminopropylcarbamoylamino)-N-(2,3-dihydro-1H-inden-2-yl)pyrazine-2-carboxamide |
| SMILES | NCCCNC(=O)Nc1nccnc1C(=O)NC1Cc2ccccc2C1 |
| InChI | InChI=1S/C18H22N6O2/c19-6-3-7-22-18(26)24-16-15(20-8-9-21-16)17(25)23-14-10-12-4-1-2-5-13(12)11-14/h1-2,4-5,8-9,14H,3,6-7,10-11,19H2,(H,23,25)(H2,21,22,24,26) |
| InChIKey | YHDOMDDHJDGMLA-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 122.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|