C22H12Cl3NO3S2 — CID 157483204
9-chlorodeca-1,2,3,4,5,6,7,9-octaene;1-[5-(2,3-dichlorophenyl)sulfanyl-4-nitrothiophen-2-yl]ethanone (PubChem CID 157483204) has the molecular formula C22H12Cl3NO3S2 and a molecular weight of 508.84 g/mol. Its IUPAC name is 9-chlorodeca-1,2,3,4,5,6,7,9-octaene;1-[5-(2,3-dichlorophenyl)sulfanyl-4-nitrothiophen-2-yl]ethanone.
| Compound Name | 9-chlorodeca-1,2,3,4,5,6,7,9-octaene;1-[5-(2,3-dichlorophenyl)sulfanyl-4-nitrothiophen-2-yl]ethanone |
|---|---|
| PubChem CID | 157483204 |
| Molecular Formula | C22H12Cl3NO3S2 |
| Molecular Weight | 508.84 g/mol |
| Exact Mass | 506.93 |
| IUPAC Name | 9-chlorodeca-1,2,3,4,5,6,7,9-octaene;1-[5-(2,3-dichlorophenyl)sulfanyl-4-nitrothiophen-2-yl]ethanone |
| SMILES | C=C=C=C=C=C=C=CC(=C)Cl.CC(=O)c1cc([N+](=O)[O-])c(Sc2cccc(Cl)c2Cl)s1 |
| InChI | InChI=1S/C12H7Cl2NO3S2.C10H5Cl/c1-6(16)10-5-8(15(17)18)12(20-10)19-9-4-2-3-7(13)11(9)14;1-3-4-5-6-7-8-9-10(2)11/h2-5H,1H3;9H,1-2H2 |
| InChIKey | CJQSUKXFFDXCBI-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.84 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|