C18H15NO — CID 157483251
1,2-dimethyl-3-phenyl-[1]benzofuro[3,2-b]pyrrole (PubChem CID 157483251) has the molecular formula C18H15NO and a molecular weight of 261.32 g/mol. Its IUPAC name is 1,2-dimethyl-3-phenyl-[1]benzofuro[3,2-b]pyrrole.
| Compound Name | 1,2-dimethyl-3-phenyl-[1]benzofuro[3,2-b]pyrrole |
|---|---|
| PubChem CID | 157483251 |
| Molecular Formula | C18H15NO |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | 1,2-dimethyl-3-phenyl-[1]benzofuro[3,2-b]pyrrole |
| SMILES | Cc1c(-c2ccccc2)c2oc3ccccc3c2n1C |
| InChI | InChI=1S/C18H15NO/c1-12-16(13-8-4-3-5-9-13)18-17(19(12)2)14-10-6-7-11-15(14)20-18/h3-11H,1-2H3 |
| InChIKey | IHHTZWOFKIUKNW-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 18.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |